C14H12Cl4N4O3 — CID 159737263
1-(3,4-dichloro-2-hydroxyphenyl)-3-(2,3-dichlorophenyl)urea;urea (PubChem CID 159737263) has the molecular formula C14H12Cl4N4O3 and a molecular weight of 426.09 g/mol. Its IUPAC name is 1-(3,4-dichloro-2-hydroxyphenyl)-3-(2,3-dichlorophenyl)urea;urea.
| Compound Name | 1-(3,4-dichloro-2-hydroxyphenyl)-3-(2,3-dichlorophenyl)urea;urea |
|---|---|
| PubChem CID | 159737263 |
| Molecular Formula | C14H12Cl4N4O3 |
| Molecular Weight | 426.09 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | 1-(3,4-dichloro-2-hydroxyphenyl)-3-(2,3-dichlorophenyl)urea;urea |
| SMILES | NC(N)=O.O=C(Nc1ccc(Cl)c(Cl)c1O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H8Cl4N2O2.CH4N2O/c14-6-2-1-3-8(10(6)16)18-13(21)19-9-5-4-7(15)11(17)12(9)20;2-1(3)4/h1-5,20H,(H2,18,19,21);(H4,2,3,4) |
| InChIKey | NBZLIBJSOOCTKZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.09 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|