C17H16Cl3N3O5S2 — CID 11627659
1-[4-chloro-2-hydroxy-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]phenyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 11627659) has the molecular formula C17H16Cl3N3O5S2 and a molecular weight of 512.82 g/mol. Its IUPAC name is 1-[4-chloro-2-hydroxy-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]phenyl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[4-chloro-2-hydroxy-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]phenyl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 11627659 |
| Molecular Formula | C17H16Cl3N3O5S2 |
| Molecular Weight | 512.82 g/mol |
| Exact Mass | 510.96 |
| IUPAC Name | 1-[4-chloro-2-hydroxy-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]phenyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)N2CCS(=O)CC2)c1O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H16Cl3N3O5S2/c18-10-2-1-3-12(14(10)20)21-17(25)22-13-5-4-11(19)16(15(13)24)30(27,28)23-6-8-29(26)9-7-23/h1-5,24H,6-9H2,(H2,21,22,25) |
| InChIKey | ZEJUGAOSIALXKD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|