C18H19Cl2N3O5S — CID 57264361
1-[4-chloro-2-hydroxy-3-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylphenyl]-3-(2-chlorophenyl)urea (PubChem CID 57264361) has the molecular formula C18H19Cl2N3O5S and a molecular weight of 460.34 g/mol. Its IUPAC name is 1-[4-chloro-2-hydroxy-3-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylphenyl]-3-(2-chlorophenyl)urea.
| Compound Name | 1-[4-chloro-2-hydroxy-3-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylphenyl]-3-(2-chlorophenyl)urea |
|---|---|
| PubChem CID | 57264361 |
| Molecular Formula | C18H19Cl2N3O5S |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 1-[4-chloro-2-hydroxy-3-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylphenyl]-3-(2-chlorophenyl)urea |
| SMILES | O=C(Nc1ccccc1Cl)Nc1ccc(Cl)c(S(=O)(=O)N2CCC[C@H]2CO)c1O |
| InChI | InChI=1S/C18H19Cl2N3O5S/c19-12-5-1-2-6-14(12)21-18(26)22-15-8-7-13(20)17(16(15)25)29(27,28)23-9-3-4-11(23)10-24/h1-2,5-8,11,24-25H,3-4,9-10H2,(H2,21,22,26)/t11-/m0/s1 |
| InChIKey | QZRLPGUYFAGAQH-NSHDSACASA-N |
| XLogP | 3.49 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|