C20H24ClN3O4S — CID 50996596
1-(4-chloro-2-hydroxy-3-piperidin-4-ylsulfonylphenyl)-3-(2-ethylphenyl)urea (PubChem CID 50996596) has the molecular formula C20H24ClN3O4S and a molecular weight of 437.95 g/mol. Its IUPAC name is 1-(4-chloro-2-hydroxy-3-piperidin-4-ylsulfonylphenyl)-3-(2-ethylphenyl)urea.
| Compound Name | 1-(4-chloro-2-hydroxy-3-piperidin-4-ylsulfonylphenyl)-3-(2-ethylphenyl)urea |
|---|---|
| PubChem CID | 50996596 |
| Molecular Formula | C20H24ClN3O4S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 1-(4-chloro-2-hydroxy-3-piperidin-4-ylsulfonylphenyl)-3-(2-ethylphenyl)urea |
| SMILES | CCc1ccccc1NC(=O)Nc1ccc(Cl)c(S(=O)(=O)C2CCNCC2)c1O |
| InChI | InChI=1S/C20H24ClN3O4S/c1-2-13-5-3-4-6-16(13)23-20(26)24-17-8-7-15(21)19(18(17)25)29(27,28)14-9-11-22-12-10-14/h3-8,14,22,25H,2,9-12H2,1H3,(H2,23,24,26) |
| InChIKey | KEIVOVSJTKSMSG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|