C21H21Cl2FN2O4S — CID 50996950
1-[3-[[(1S,5S)-3-bicyclo[3.2.1]octanyl]sulfonyl]-4-chloro-2-hydroxyphenyl]-3-(2-chloro-3-fluorophenyl)urea (PubChem CID 50996950) has the molecular formula C21H21Cl2FN2O4S and a molecular weight of 487.38 g/mol. Its IUPAC name is 1-[3-[[(1S,5S)-3-bicyclo[3.2.1]octanyl]sulfonyl]-4-chloro-2-hydroxyphenyl]-3-(2-chloro-3-fluorophenyl)urea.
| Compound Name | 1-[3-[[(1S,5S)-3-bicyclo[3.2.1]octanyl]sulfonyl]-4-chloro-2-hydroxyphenyl]-3-(2-chloro-3-fluorophenyl)urea |
|---|---|
| PubChem CID | 50996950 |
| Molecular Formula | C21H21Cl2FN2O4S |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 1-[3-[[(1S,5S)-3-bicyclo[3.2.1]octanyl]sulfonyl]-4-chloro-2-hydroxyphenyl]-3-(2-chloro-3-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)C2C[C@H]3CC[C@H](C2)C3)c1O)Nc1cccc(F)c1Cl |
| InChI | InChI=1S/C21H21Cl2FN2O4S/c22-14-6-7-17(26-21(28)25-16-3-1-2-15(24)18(16)23)19(27)20(14)31(29,30)13-9-11-4-5-12(8-11)10-13/h1-3,6-7,11-13,27H,4-5,8-10H2,(H2,25,26,28)/t11-,12-/m0/s1 |
| InChIKey | DWQXBWGTAJDFCE-RYUDHWBXSA-N |
| XLogP | 5.83 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|