C18H18ClFN2O4S — CID 58180208
1-(4-chloro-3-cyclobutylsulfonyl-2-hydroxyphenyl)-3-(3-fluoro-2-methylphenyl)urea (PubChem CID 58180208) has the molecular formula C18H18ClFN2O4S and a molecular weight of 412.87 g/mol. Its IUPAC name is 1-(4-chloro-3-cyclobutylsulfonyl-2-hydroxyphenyl)-3-(3-fluoro-2-methylphenyl)urea.
| Compound Name | 1-(4-chloro-3-cyclobutylsulfonyl-2-hydroxyphenyl)-3-(3-fluoro-2-methylphenyl)urea |
|---|---|
| PubChem CID | 58180208 |
| Molecular Formula | C18H18ClFN2O4S |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 1-(4-chloro-3-cyclobutylsulfonyl-2-hydroxyphenyl)-3-(3-fluoro-2-methylphenyl)urea |
| SMILES | Cc1c(F)cccc1NC(=O)Nc1ccc(Cl)c(S(=O)(=O)C2CCC2)c1O |
| InChI | InChI=1S/C18H18ClFN2O4S/c1-10-13(20)6-3-7-14(10)21-18(24)22-15-9-8-12(19)17(16(15)23)27(25,26)11-4-2-5-11/h3,6-9,11,23H,2,4-5H2,1H3,(H2,21,22,24) |
| InChIKey | GCQKJESHSXHQRI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|