C18H19ClN2O5S — CID 155249041
1-(4-chloro-3-cyclopropylsulfonyl-2-hydroxyphenyl)-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea (PubChem CID 155249041) has the molecular formula C18H19ClN2O5S and a molecular weight of 410.88 g/mol. Its IUPAC name is 1-(4-chloro-3-cyclopropylsulfonyl-2-hydroxyphenyl)-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea.
| Compound Name | 1-(4-chloro-3-cyclopropylsulfonyl-2-hydroxyphenyl)-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea |
|---|---|
| PubChem CID | 155249041 |
| Molecular Formula | C18H19ClN2O5S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1-(4-chloro-3-cyclopropylsulfonyl-2-hydroxyphenyl)-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)C2CC2)c1O)N[C@H]1CCCc2ccoc21 |
| InChI | InChI=1S/C18H19ClN2O5S/c19-12-6-7-13(15(22)17(12)27(24,25)11-4-5-11)20-18(23)21-14-3-1-2-10-8-9-26-16(10)14/h6-9,11,14,22H,1-5H2,(H2,20,21,23)/t14-/m0/s1 |
| InChIKey | SBABSCLMMSKVON-AWEZNQCLSA-N |
| XLogP | 3.77 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|