C19H21ClN2O7S — CID 146906672
ethyl 2-[6-chloro-2-hydroxy-3-(4,5,6,7-tetrahydro-1-benzofuran-7-ylcarbamoylamino)phenyl]sulfonylacetate (PubChem CID 146906672) has the molecular formula C19H21ClN2O7S and a molecular weight of 456.90 g/mol. Its IUPAC name is ethyl 2-[6-chloro-2-hydroxy-3-(4,5,6,7-tetrahydro-1-benzofuran-7-ylcarbamoylamino)phenyl]sulfonylacetate.
| Compound Name | ethyl 2-[6-chloro-2-hydroxy-3-(4,5,6,7-tetrahydro-1-benzofuran-7-ylcarbamoylamino)phenyl]sulfonylacetate |
|---|---|
| PubChem CID | 146906672 |
| Molecular Formula | C19H21ClN2O7S |
| Molecular Weight | 456.90 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | ethyl 2-[6-chloro-2-hydroxy-3-(4,5,6,7-tetrahydro-1-benzofuran-7-ylcarbamoylamino)phenyl]sulfonylacetate |
| SMILES | CCOC(=O)CS(=O)(=O)c1c(Cl)ccc(NC(=O)NC2CCCc3ccoc32)c1O |
| InChI | InChI=1S/C19H21ClN2O7S/c1-2-28-15(23)10-30(26,27)18-12(20)6-7-13(16(18)24)21-19(25)22-14-5-3-4-11-8-9-29-17(11)14/h6-9,14,24H,2-5,10H2,1H3,(H2,21,22,25) |
| InChIKey | AAMSGWWAPBSBPS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.90 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|