C20H25Cl2N3O4S — CID 129316070
1-[(1R)-2-chlorocyclopent-2-en-1-yl]-3-[4-chloro-2-hydroxy-3-(3-pyrrolidin-1-ylcyclobutyl)sulfonylphenyl]urea (PubChem CID 129316070) has the molecular formula C20H25Cl2N3O4S and a molecular weight of 474.41 g/mol. Its IUPAC name is 1-[(1R)-2-chlorocyclopent-2-en-1-yl]-3-[4-chloro-2-hydroxy-3-(3-pyrrolidin-1-ylcyclobutyl)sulfonylphenyl]urea.
| Compound Name | 1-[(1R)-2-chlorocyclopent-2-en-1-yl]-3-[4-chloro-2-hydroxy-3-(3-pyrrolidin-1-ylcyclobutyl)sulfonylphenyl]urea |
|---|---|
| PubChem CID | 129316070 |
| Molecular Formula | C20H25Cl2N3O4S |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 1-[(1R)-2-chlorocyclopent-2-en-1-yl]-3-[4-chloro-2-hydroxy-3-(3-pyrrolidin-1-ylcyclobutyl)sulfonylphenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)C2CC(N3CCCC3)C2)c1O)N[C@@H]1CCC=C1Cl |
| InChI | InChI=1S/C20H25Cl2N3O4S/c21-14-4-3-5-16(14)23-20(27)24-17-7-6-15(22)19(18(17)26)30(28,29)13-10-12(11-13)25-8-1-2-9-25/h4,6-7,12-13,16,26H,1-3,5,8-11H2,(H2,23,24,27)/t12?,13?,16-/m1/s1 |
| InChIKey | YZRJUQNDFMWNIA-SEEARECTSA-N |
| XLogP | 3.85 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|