C14H14Cl2F2N2O4S — CID 123701572
1-(2-chlorocyclopent-2-en-1-yl)-3-[4-chloro-3-(1,1-difluoroethylsulfonyl)-2-hydroxyphenyl]urea (PubChem CID 123701572) has the molecular formula C14H14Cl2F2N2O4S and a molecular weight of 415.25 g/mol. Its IUPAC name is 1-(2-chlorocyclopent-2-en-1-yl)-3-[4-chloro-3-(1,1-difluoroethylsulfonyl)-2-hydroxyphenyl]urea.
| Compound Name | 1-(2-chlorocyclopent-2-en-1-yl)-3-[4-chloro-3-(1,1-difluoroethylsulfonyl)-2-hydroxyphenyl]urea |
|---|---|
| PubChem CID | 123701572 |
| Molecular Formula | C14H14Cl2F2N2O4S |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 1-(2-chlorocyclopent-2-en-1-yl)-3-[4-chloro-3-(1,1-difluoroethylsulfonyl)-2-hydroxyphenyl]urea |
| SMILES | CC(F)(F)S(=O)(=O)c1c(Cl)ccc(NC(=O)NC2CCC=C2Cl)c1O |
| InChI | InChI=1S/C14H14Cl2F2N2O4S/c1-14(17,18)25(23,24)12-8(16)5-6-10(11(12)21)20-13(22)19-9-4-2-3-7(9)15/h3,5-6,9,21H,2,4H2,1H3,(H2,19,20,22) |
| InChIKey | CWCSRMNYJVURNE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|