C17H22ClN3O5S — CID 118554797
1-(4-chloro-2-hydroxy-3-morpholin-4-ylsulfonylphenyl)-3-(2-methylcyclopent-2-en-1-yl)urea (PubChem CID 118554797) has the molecular formula C17H22ClN3O5S and a molecular weight of 415.90 g/mol. Its IUPAC name is 1-(4-chloro-2-hydroxy-3-morpholin-4-ylsulfonylphenyl)-3-(2-methylcyclopent-2-en-1-yl)urea.
| Compound Name | 1-(4-chloro-2-hydroxy-3-morpholin-4-ylsulfonylphenyl)-3-(2-methylcyclopent-2-en-1-yl)urea |
|---|---|
| PubChem CID | 118554797 |
| Molecular Formula | C17H22ClN3O5S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-(4-chloro-2-hydroxy-3-morpholin-4-ylsulfonylphenyl)-3-(2-methylcyclopent-2-en-1-yl)urea |
| SMILES | CC1=CCCC1NC(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1O |
| InChI | InChI=1S/C17H22ClN3O5S/c1-11-3-2-4-13(11)19-17(23)20-14-6-5-12(18)16(15(14)22)27(24,25)21-7-9-26-10-8-21/h3,5-6,13,22H,2,4,7-10H2,1H3,(H2,19,20,23) |
| InChIKey | UZJCSUBHJWDZNX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|