C18H21Cl2FN2O5S — CID 123799150
1-[(2-chlorocyclopent-2-en-1-yl)methyl]-3-[4-chloro-3-(4-fluorooxan-4-yl)sulfonyl-2-hydroxyphenyl]urea (PubChem CID 123799150) has the molecular formula C18H21Cl2FN2O5S and a molecular weight of 467.35 g/mol. Its IUPAC name is 1-[(2-chlorocyclopent-2-en-1-yl)methyl]-3-[4-chloro-3-(4-fluorooxan-4-yl)sulfonyl-2-hydroxyphenyl]urea.
| Compound Name | 1-[(2-chlorocyclopent-2-en-1-yl)methyl]-3-[4-chloro-3-(4-fluorooxan-4-yl)sulfonyl-2-hydroxyphenyl]urea |
|---|---|
| PubChem CID | 123799150 |
| Molecular Formula | C18H21Cl2FN2O5S |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 1-[(2-chlorocyclopent-2-en-1-yl)methyl]-3-[4-chloro-3-(4-fluorooxan-4-yl)sulfonyl-2-hydroxyphenyl]urea |
| SMILES | O=C(NCC1CCC=C1Cl)Nc1ccc(Cl)c(S(=O)(=O)C2(F)CCOCC2)c1O |
| InChI | InChI=1S/C18H21Cl2FN2O5S/c19-12-3-1-2-11(12)10-22-17(25)23-14-5-4-13(20)16(15(14)24)29(26,27)18(21)6-8-28-9-7-18/h3-5,11,24H,1-2,6-10H2,(H2,22,23,25) |
| InChIKey | VVGKQTXBLZWCDB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|