C17H20Cl2N2O5S — CID 118554756
1-(2-chlorocyclopent-2-en-1-yl)-3-[4-chloro-2-hydroxy-3-(oxan-4-ylsulfonyl)phenyl]urea (PubChem CID 118554756) has the molecular formula C17H20Cl2N2O5S and a molecular weight of 435.33 g/mol. Its IUPAC name is 1-(2-chlorocyclopent-2-en-1-yl)-3-[4-chloro-2-hydroxy-3-(oxan-4-ylsulfonyl)phenyl]urea.
| Compound Name | 1-(2-chlorocyclopent-2-en-1-yl)-3-[4-chloro-2-hydroxy-3-(oxan-4-ylsulfonyl)phenyl]urea |
|---|---|
| PubChem CID | 118554756 |
| Molecular Formula | C17H20Cl2N2O5S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 1-(2-chlorocyclopent-2-en-1-yl)-3-[4-chloro-2-hydroxy-3-(oxan-4-ylsulfonyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)C2CCOCC2)c1O)NC1CCC=C1Cl |
| InChI | InChI=1S/C17H20Cl2N2O5S/c18-11-2-1-3-13(11)20-17(23)21-14-5-4-12(19)16(15(14)22)27(24,25)10-6-8-26-9-7-10/h2,4-5,10,13,22H,1,3,6-9H2,(H2,20,21,23) |
| InChIKey | HCTDBHXSZBTOCN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|