C11H14ClNO4S — CID 123742707
6-amino-3-chloro-2-(oxan-4-ylsulfonyl)phenol (PubChem CID 123742707) has the molecular formula C11H14ClNO4S and a molecular weight of 291.76 g/mol. Its IUPAC name is 6-amino-3-chloro-2-(oxan-4-ylsulfonyl)phenol.
| Compound Name | 6-amino-3-chloro-2-(oxan-4-ylsulfonyl)phenol |
|---|---|
| PubChem CID | 123742707 |
| Molecular Formula | C11H14ClNO4S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 6-amino-3-chloro-2-(oxan-4-ylsulfonyl)phenol |
| SMILES | Nc1ccc(Cl)c(S(=O)(=O)C2CCOCC2)c1O |
| InChI | InChI=1S/C11H14ClNO4S/c12-8-1-2-9(13)10(14)11(8)18(15,16)7-3-5-17-6-4-7/h1-2,7,14H,3-6,13H2 |
| InChIKey | PGKOJCCYRFLBSO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|