C10H12ClNO4S — CID 118540723
6-amino-3-chloro-2-(oxolan-3-ylsulfonyl)phenol (PubChem CID 118540723) has the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. Its IUPAC name is 6-amino-3-chloro-2-(oxolan-3-ylsulfonyl)phenol.
| Compound Name | 6-amino-3-chloro-2-(oxolan-3-ylsulfonyl)phenol |
|---|---|
| PubChem CID | 118540723 |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 6-amino-3-chloro-2-(oxolan-3-ylsulfonyl)phenol |
| SMILES | Nc1ccc(Cl)c(S(=O)(=O)C2CCOC2)c1O |
| InChI | InChI=1S/C10H12ClNO4S/c11-7-1-2-8(12)9(13)10(7)17(14,15)6-3-4-16-5-6/h1-2,6,13H,3-5,12H2 |
| InChIKey | QWWMBAXCIBYQGE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|