C19H32ClFN2O3S — CID 144967064
6-amino-3-chloro-2-(1-cyclobutyl-4-fluoropiperidin-4-yl)sulfonylphenol;ethane (PubChem CID 144967064) has the molecular formula C19H32ClFN2O3S and a molecular weight of 422.99 g/mol. Its IUPAC name is 6-amino-3-chloro-2-(1-cyclobutyl-4-fluoropiperidin-4-yl)sulfonylphenol;ethane.
| Compound Name | 6-amino-3-chloro-2-(1-cyclobutyl-4-fluoropiperidin-4-yl)sulfonylphenol;ethane |
|---|---|
| PubChem CID | 144967064 |
| Molecular Formula | C19H32ClFN2O3S |
| Molecular Weight | 422.99 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 6-amino-3-chloro-2-(1-cyclobutyl-4-fluoropiperidin-4-yl)sulfonylphenol;ethane |
| SMILES | CC.CC.Nc1ccc(Cl)c(S(=O)(=O)C2(F)CCN(C3CCC3)CC2)c1O |
| InChI | InChI=1S/C15H20ClFN2O3S.2C2H6/c16-11-4-5-12(18)13(20)14(11)23(21,22)15(17)6-8-19(9-7-15)10-2-1-3-10;2*1-2/h4-5,10,20H,1-3,6-9,18H2;2*1-2H3 |
| InChIKey | DIKUDQJBLXDKRO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.99 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|