C9H9ClFNO4S — CID 118540480
6-amino-3-chloro-2-(3-fluorooxetan-3-yl)sulfonylphenol (PubChem CID 118540480) has the molecular formula C9H9ClFNO4S and a molecular weight of 281.69 g/mol. Its IUPAC name is 6-amino-3-chloro-2-(3-fluorooxetan-3-yl)sulfonylphenol.
| Compound Name | 6-amino-3-chloro-2-(3-fluorooxetan-3-yl)sulfonylphenol |
|---|---|
| PubChem CID | 118540480 |
| Molecular Formula | C9H9ClFNO4S |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 6-amino-3-chloro-2-(3-fluorooxetan-3-yl)sulfonylphenol |
| SMILES | Nc1ccc(Cl)c(S(=O)(=O)C2(F)COC2)c1O |
| InChI | InChI=1S/C9H9ClFNO4S/c10-5-1-2-6(12)7(13)8(5)17(14,15)9(11)3-16-4-9/h1-2,13H,3-4,12H2 |
| InChIKey | VNBVVINYVQZERI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|