C8H8ClF2NO3S — CID 118540487
6-amino-3-chloro-2-(1,1-difluoroethylsulfonyl)phenol (PubChem CID 118540487) has the molecular formula C8H8ClF2NO3S and a molecular weight of 271.67 g/mol. Its IUPAC name is 6-amino-3-chloro-2-(1,1-difluoroethylsulfonyl)phenol.
| Compound Name | 6-amino-3-chloro-2-(1,1-difluoroethylsulfonyl)phenol |
|---|---|
| PubChem CID | 118540487 |
| Molecular Formula | C8H8ClF2NO3S |
| Molecular Weight | 271.67 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 6-amino-3-chloro-2-(1,1-difluoroethylsulfonyl)phenol |
| SMILES | CC(F)(F)S(=O)(=O)c1c(Cl)ccc(N)c1O |
| InChI | InChI=1S/C8H8ClF2NO3S/c1-8(10,11)16(14,15)7-4(9)2-3-5(12)6(7)13/h2-3,13H,12H2,1H3 |
| InChIKey | DQYZQMFWWQNKGC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.67 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|