C9H10ClFN2O3S — CID 118540555
6-amino-3-chloro-2-(3-fluoroazetidin-1-yl)sulfonylphenol (PubChem CID 118540555) has the molecular formula C9H10ClFN2O3S and a molecular weight of 280.71 g/mol. Its IUPAC name is 6-amino-3-chloro-2-(3-fluoroazetidin-1-yl)sulfonylphenol.
| Compound Name | 6-amino-3-chloro-2-(3-fluoroazetidin-1-yl)sulfonylphenol |
|---|---|
| PubChem CID | 118540555 |
| Molecular Formula | C9H10ClFN2O3S |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 6-amino-3-chloro-2-(3-fluoroazetidin-1-yl)sulfonylphenol |
| SMILES | Nc1ccc(Cl)c(S(=O)(=O)N2CC(F)C2)c1O |
| InChI | InChI=1S/C9H10ClFN2O3S/c10-6-1-2-7(12)8(14)9(6)17(15,16)13-3-5(11)4-13/h1-2,5,14H,3-4,12H2 |
| InChIKey | YZPOCPHYMGJMEN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|