C10H11ClF3NO3S — CID 118540477
6-amino-3-chloro-2-(1,1,1-trifluoro-2-methylpropan-2-yl)sulfonylphenol (PubChem CID 118540477) has the molecular formula C10H11ClF3NO3S and a molecular weight of 317.72 g/mol. Its IUPAC name is 6-amino-3-chloro-2-(1,1,1-trifluoro-2-methylpropan-2-yl)sulfonylphenol.
| Compound Name | 6-amino-3-chloro-2-(1,1,1-trifluoro-2-methylpropan-2-yl)sulfonylphenol |
|---|---|
| PubChem CID | 118540477 |
| Molecular Formula | C10H11ClF3NO3S |
| Molecular Weight | 317.72 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 6-amino-3-chloro-2-(1,1,1-trifluoro-2-methylpropan-2-yl)sulfonylphenol |
| SMILES | CC(C)(C(F)(F)F)S(=O)(=O)c1c(Cl)ccc(N)c1O |
| InChI | InChI=1S/C10H11ClF3NO3S/c1-9(2,10(12,13)14)19(17,18)8-5(11)3-4-6(15)7(8)16/h3-4,16H,15H2,1-2H3 |
| InChIKey | BPQMXZJAHNXGMY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.72 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|