About 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol
6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol (PubChem CID 118540353) has the molecular formula C10H11ClF2N2O3S
and a molecular weight of 312.73 g/mol. Its IUPAC name is 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol.
Molecular Properties
| Compound Name | 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol |
| PubChem CID | 118540353 |
| Molecular Formula | C10H11ClF2N2O3S |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol |
| SMILES | Nc1ccc(Cl)c(S(=O)(=O)N2CCC(F)(F)C2)c1O |
| InChI | InChI=1S/C10H11ClF2N2O3S/c11-6-1-2-7(14)8(16)9(6)19(17,18)15-4-3-10(12,13)5-15/h1-2,16H,3-5,14H2 |
| InChIKey | ZTINIIBBZSQECB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol?
The IUPAC name of 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol (CID 118540353) is 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol.
What is the SMILES notation for 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol?
The canonical SMILES for 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol is Nc1ccc(Cl)c(S(=O)(=O)N2CCC(F)(F)C2)c1O.
What is the InChIKey of 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol?
The InChIKey is ZTINIIBBZSQECB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClF2N2O3S/c11-6-1-2-7(14)8(16)9(6)19(17,18)15-4-3-10(12,13)5-15/h1-2,16H,3-5,14H2.
What are the key properties of 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol?
6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol has a molecular weight of 312.73 g/mol, XLogP of 1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)sulfonylphenol is sourced from PubChem (CID 118540353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).