C17H20ClN3O4S — CID 129315963
1-(3-tert-butylsulfonyl-4-cyano-2-hydroxyphenyl)-3-[(1R)-2-chlorocyclopent-2-en-1-yl]urea (PubChem CID 129315963) has the molecular formula C17H20ClN3O4S and a molecular weight of 397.88 g/mol. Its IUPAC name is 1-(3-tert-butylsulfonyl-4-cyano-2-hydroxyphenyl)-3-[(1R)-2-chlorocyclopent-2-en-1-yl]urea.
| Compound Name | 1-(3-tert-butylsulfonyl-4-cyano-2-hydroxyphenyl)-3-[(1R)-2-chlorocyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 129315963 |
| Molecular Formula | C17H20ClN3O4S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 1-(3-tert-butylsulfonyl-4-cyano-2-hydroxyphenyl)-3-[(1R)-2-chlorocyclopent-2-en-1-yl]urea |
| SMILES | CC(C)(C)S(=O)(=O)c1c(C#N)ccc(NC(=O)N[C@@H]2CCC=C2Cl)c1O |
| InChI | InChI=1S/C17H20ClN3O4S/c1-17(2,3)26(24,25)15-10(9-19)7-8-13(14(15)22)21-16(23)20-12-6-4-5-11(12)18/h5,7-8,12,22H,4,6H2,1-3H3,(H2,20,21,23)/t12-/m1/s1 |
| InChIKey | BHWKAEZPMCPUGV-GFCCVEGCSA-N |
| XLogP | 3.24 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|