C17H21ClN2O5S — CID 144967279
1-[4-chloro-2-hydroxy-3-(3-hydroxycyclobutyl)sulfonylphenyl]-3-[(1R)-2-methylcyclopent-2-en-1-yl]urea (PubChem CID 144967279) has the molecular formula C17H21ClN2O5S and a molecular weight of 400.88 g/mol. Its IUPAC name is 1-[4-chloro-2-hydroxy-3-(3-hydroxycyclobutyl)sulfonylphenyl]-3-[(1R)-2-methylcyclopent-2-en-1-yl]urea.
| Compound Name | 1-[4-chloro-2-hydroxy-3-(3-hydroxycyclobutyl)sulfonylphenyl]-3-[(1R)-2-methylcyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 144967279 |
| Molecular Formula | C17H21ClN2O5S |
| Molecular Weight | 400.88 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-[4-chloro-2-hydroxy-3-(3-hydroxycyclobutyl)sulfonylphenyl]-3-[(1R)-2-methylcyclopent-2-en-1-yl]urea |
| SMILES | CC1=CCC[C@H]1NC(=O)Nc1ccc(Cl)c(S(=O)(=O)C2CC(O)C2)c1O |
| InChI | InChI=1S/C17H21ClN2O5S/c1-9-3-2-4-13(9)19-17(23)20-14-6-5-12(18)16(15(14)22)26(24,25)11-7-10(21)8-11/h3,5-6,10-11,13,21-22H,2,4,7-8H2,1H3,(H2,19,20,23)/t10?,11?,13-/m1/s1 |
| InChIKey | UNLNRDWNLPZZRP-GCZXYKMCSA-N |
| XLogP | 2.57 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.88 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|