C20H22ClN3O4S — CID 123814705
1-[4-chloro-2-hydroxy-3-(1-pyridin-2-ylethylsulfonyl)phenyl]-3-(2-methylcyclopent-2-en-1-yl)urea (PubChem CID 123814705) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is 1-[4-chloro-2-hydroxy-3-(1-pyridin-2-ylethylsulfonyl)phenyl]-3-(2-methylcyclopent-2-en-1-yl)urea.
| Compound Name | 1-[4-chloro-2-hydroxy-3-(1-pyridin-2-ylethylsulfonyl)phenyl]-3-(2-methylcyclopent-2-en-1-yl)urea |
|---|---|
| PubChem CID | 123814705 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 1-[4-chloro-2-hydroxy-3-(1-pyridin-2-ylethylsulfonyl)phenyl]-3-(2-methylcyclopent-2-en-1-yl)urea |
| SMILES | CC1=CCCC1NC(=O)Nc1ccc(Cl)c(S(=O)(=O)C(C)c2ccccn2)c1O |
| InChI | InChI=1S/C20H22ClN3O4S/c1-12-6-5-8-15(12)23-20(26)24-17-10-9-14(21)19(18(17)25)29(27,28)13(2)16-7-3-4-11-22-16/h3-4,6-7,9-11,13,15,25H,5,8H2,1-2H3,(H2,23,24,26) |
| InChIKey | ZSEIQBIEPZNMSE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|