C18H24Cl2N2O5S — CID 129315986
1-(2-chlorocyclopent-2-en-1-yl)-3-[4-chloro-3-(1-ethoxy-2-methylpropan-2-yl)sulfonyl-2-hydroxyphenyl]urea (PubChem CID 129315986) has the molecular formula C18H24Cl2N2O5S and a molecular weight of 451.37 g/mol. Its IUPAC name is 1-(2-chlorocyclopent-2-en-1-yl)-3-[4-chloro-3-(1-ethoxy-2-methylpropan-2-yl)sulfonyl-2-hydroxyphenyl]urea.
| Compound Name | 1-(2-chlorocyclopent-2-en-1-yl)-3-[4-chloro-3-(1-ethoxy-2-methylpropan-2-yl)sulfonyl-2-hydroxyphenyl]urea |
|---|---|
| PubChem CID | 129315986 |
| Molecular Formula | C18H24Cl2N2O5S |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 1-(2-chlorocyclopent-2-en-1-yl)-3-[4-chloro-3-(1-ethoxy-2-methylpropan-2-yl)sulfonyl-2-hydroxyphenyl]urea |
| SMILES | CCOCC(C)(C)S(=O)(=O)c1c(Cl)ccc(NC(=O)NC2CCC=C2Cl)c1O |
| InChI | InChI=1S/C18H24Cl2N2O5S/c1-4-27-10-18(2,3)28(25,26)16-12(20)8-9-14(15(16)23)22-17(24)21-13-7-5-6-11(13)19/h6,8-9,13,23H,4-5,7,10H2,1-3H3,(H2,21,22,24) |
| InChIKey | AUQZENTVBAUCFA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|