C18H21ClF2N2O4S — CID 123246393
1-[4-chloro-3-[3-(difluoromethyl)cyclobutyl]sulfonyl-2-hydroxyphenyl]-3-(2-methylcyclopent-2-en-1-yl)urea (PubChem CID 123246393) has the molecular formula C18H21ClF2N2O4S and a molecular weight of 434.89 g/mol. Its IUPAC name is 1-[4-chloro-3-[3-(difluoromethyl)cyclobutyl]sulfonyl-2-hydroxyphenyl]-3-(2-methylcyclopent-2-en-1-yl)urea.
| Compound Name | 1-[4-chloro-3-[3-(difluoromethyl)cyclobutyl]sulfonyl-2-hydroxyphenyl]-3-(2-methylcyclopent-2-en-1-yl)urea |
|---|---|
| PubChem CID | 123246393 |
| Molecular Formula | C18H21ClF2N2O4S |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 1-[4-chloro-3-[3-(difluoromethyl)cyclobutyl]sulfonyl-2-hydroxyphenyl]-3-(2-methylcyclopent-2-en-1-yl)urea |
| SMILES | CC1=CCCC1NC(=O)Nc1ccc(Cl)c(S(=O)(=O)C2CC(C(F)F)C2)c1O |
| InChI | InChI=1S/C18H21ClF2N2O4S/c1-9-3-2-4-13(9)22-18(25)23-14-6-5-12(19)16(15(14)24)28(26,27)11-7-10(8-11)17(20)21/h3,5-6,10-11,13,17,24H,2,4,7-8H2,1H3,(H2,22,23,25) |
| InChIKey | SZKAYNUTBSYBLK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|