C20H26ClF2N3O4S — CID 123888434
1-[4-chloro-3-[1-(2,2-difluoroethyl)piperidin-4-yl]sulfonyl-2-hydroxyphenyl]-3-(2-methylcyclopent-2-en-1-yl)urea (PubChem CID 123888434) has the molecular formula C20H26ClF2N3O4S and a molecular weight of 477.96 g/mol. Its IUPAC name is 1-[4-chloro-3-[1-(2,2-difluoroethyl)piperidin-4-yl]sulfonyl-2-hydroxyphenyl]-3-(2-methylcyclopent-2-en-1-yl)urea.
| Compound Name | 1-[4-chloro-3-[1-(2,2-difluoroethyl)piperidin-4-yl]sulfonyl-2-hydroxyphenyl]-3-(2-methylcyclopent-2-en-1-yl)urea |
|---|---|
| PubChem CID | 123888434 |
| Molecular Formula | C20H26ClF2N3O4S |
| Molecular Weight | 477.96 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 1-[4-chloro-3-[1-(2,2-difluoroethyl)piperidin-4-yl]sulfonyl-2-hydroxyphenyl]-3-(2-methylcyclopent-2-en-1-yl)urea |
| SMILES | CC1=CCCC1NC(=O)Nc1ccc(Cl)c(S(=O)(=O)C2CCN(CC(F)F)CC2)c1O |
| InChI | InChI=1S/C20H26ClF2N3O4S/c1-12-3-2-4-15(12)24-20(28)25-16-6-5-14(21)19(18(16)27)31(29,30)13-7-9-26(10-8-13)11-17(22)23/h3,5-6,13,15,17,27H,2,4,7-11H2,1H3,(H2,24,25,28) |
| InChIKey | ATFBKLGHAGMROA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.96 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|