C32H33ClN4O6S — CID 118540597
9H-fluoren-9-ylmethyl 4-[6-chloro-2-hydroxy-3-[[(1R)-2-methylcyclopent-2-en-1-yl]carbamoylamino]phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 118540597) has the molecular formula C32H33ClN4O6S and a molecular weight of 637.16 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4-[6-chloro-2-hydroxy-3-[[(1R)-2-methylcyclopent-2-en-1-yl]carbamoylamino]phenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 4-[6-chloro-2-hydroxy-3-[[(1R)-2-methylcyclopent-2-en-1-yl]carbamoylamino]phenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 118540597 |
| Molecular Formula | C32H33ClN4O6S |
| Molecular Weight | 637.16 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4-[6-chloro-2-hydroxy-3-[[(1R)-2-methylcyclopent-2-en-1-yl]carbamoylamino]phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | CC1=CCC[C@H]1NC(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCN(C(=O)OCC3c4ccccc4-c4ccccc43)CC2)c1O |
| InChI | InChI=1S/C32H33ClN4O6S/c1-20-7-6-12-27(20)34-31(39)35-28-14-13-26(33)30(29(28)38)44(41,42)37-17-15-36(16-18-37)32(40)43-19-25-23-10-4-2-8-21(23)22-9-3-5-11-24(22)25/h2-5,7-11,13-14,25,27,38H,6,12,15-19H2,1H3,(H2,34,35,39)/t27-/m1/s1 |
| InChIKey | BAFNGKZBNMQGSJ-HHHXNRCGSA-N |
| XLogP | 5.53 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.16 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|