C21H23NO3 — CID 63310303
9H-fluoren-9-ylmethyl 4-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 63310303) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 4-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 63310303 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1CCC(CO)CC1 |
| InChI | InChI=1S/C21H23NO3/c23-13-15-9-11-22(12-10-15)21(24)25-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,15,20,23H,9-14H2 |
| InChIKey | YYTSXYVXBGQKCP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |