C21H25N2O2+ — CID 7010657
[1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-4-yl]methylazanium (PubChem CID 7010657) has the molecular formula C21H25N2O2+ and a molecular weight of 337.44 g/mol. Its IUPAC name is [1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-4-yl]methylazanium.
| Compound Name | [1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-4-yl]methylazanium |
|---|---|
| PubChem CID | 7010657 |
| Molecular Formula | C21H25N2O2+ |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-4-yl]methylazanium |
| SMILES | [NH3+]CC1CCN(C(=O)OCC2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C21H24N2O2/c22-13-15-9-11-23(12-10-15)21(24)25-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,15,20H,9-14,22H2/p+1 |
| InChIKey | KKDUEQBKFRCXSH-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |