C22H25NO3 — CID 106837102
9H-fluoren-9-ylmethyl 4-(1-hydroxyethyl)piperidine-1-carboxylate (PubChem CID 106837102) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4-(1-hydroxyethyl)piperidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 4-(1-hydroxyethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 106837102 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4-(1-hydroxyethyl)piperidine-1-carboxylate |
| SMILES | CC(O)C1CCN(C(=O)OCC2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C22H25NO3/c1-15(24)16-10-12-23(13-11-16)22(25)26-14-21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21/h2-9,15-16,21,24H,10-14H2,1H3 |
| InChIKey | WSKZCILRAJOQCX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |