C19H19NO4S — CID 58283098
9H-fluoren-9-ylmethyl 1,1-dioxo-1,4-thiazinane-4-carboxylate (PubChem CID 58283098) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 1,1-dioxo-1,4-thiazinane-4-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 1,1-dioxo-1,4-thiazinane-4-carboxylate |
|---|---|
| PubChem CID | 58283098 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 1,1-dioxo-1,4-thiazinane-4-carboxylate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C19H19NO4S/c21-19(20-9-11-25(22,23)12-10-20)24-13-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,18H,9-13H2 |
| InChIKey | QJVGRWGBGKXIIJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |