C17H19ClN2O5S — CID 155249112
1-(4-chloro-3-ethylsulfonyl-2-hydroxyphenyl)-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea (PubChem CID 155249112) has the molecular formula C17H19ClN2O5S and a molecular weight of 398.87 g/mol. Its IUPAC name is 1-(4-chloro-3-ethylsulfonyl-2-hydroxyphenyl)-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea.
| Compound Name | 1-(4-chloro-3-ethylsulfonyl-2-hydroxyphenyl)-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea |
|---|---|
| PubChem CID | 155249112 |
| Molecular Formula | C17H19ClN2O5S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 1-(4-chloro-3-ethylsulfonyl-2-hydroxyphenyl)-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea |
| SMILES | CCS(=O)(=O)c1c(Cl)ccc(NC(=O)N[C@H]2CCCc3ccoc32)c1O |
| InChI | InChI=1S/C17H19ClN2O5S/c1-2-26(23,24)16-11(18)6-7-12(14(16)21)19-17(22)20-13-5-3-4-10-8-9-25-15(10)13/h6-9,13,21H,2-5H2,1H3,(H2,19,20,22)/t13-/m0/s1 |
| InChIKey | KWHDNBOGGFSOLB-ZDUSSCGKSA-N |
| XLogP | 3.63 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|