C12H16ClN3O5S — CID 10269300
1-(4-chloro-2-hydroxy-3-sulfamoylphenyl)-3-(oxan-2-yl)urea (PubChem CID 10269300) has the molecular formula C12H16ClN3O5S and a molecular weight of 349.80 g/mol. Its IUPAC name is 1-(4-chloro-2-hydroxy-3-sulfamoylphenyl)-3-(oxan-2-yl)urea.
| Compound Name | 1-(4-chloro-2-hydroxy-3-sulfamoylphenyl)-3-(oxan-2-yl)urea |
|---|---|
| PubChem CID | 10269300 |
| Molecular Formula | C12H16ClN3O5S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 1-(4-chloro-2-hydroxy-3-sulfamoylphenyl)-3-(oxan-2-yl)urea |
| SMILES | NS(=O)(=O)c1c(Cl)ccc(NC(=O)NC2CCCCO2)c1O |
| InChI | InChI=1S/C12H16ClN3O5S/c13-7-4-5-8(10(17)11(7)22(14,19)20)15-12(18)16-9-3-1-2-6-21-9/h4-5,9,17H,1-3,6H2,(H2,14,19,20)(H2,15,16,18) |
| InChIKey | VAJDPANPZHGXTF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|