C11H13ClN2O2 — CID 110706711
1-(4-chlorophenyl)-3-(oxolan-2-yl)urea (PubChem CID 110706711) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(oxolan-2-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(oxolan-2-yl)urea |
|---|---|
| PubChem CID | 110706711 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(oxolan-2-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1CCCO1 |
| InChI | InChI=1S/C11H13ClN2O2/c12-8-3-5-9(6-4-8)13-11(15)14-10-2-1-7-16-10/h3-6,10H,1-2,7H2,(H2,13,14,15) |
| InChIKey | WOHLXQRPGJLHND-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |