C13H15ClN2O4 — CID 73138755
1-(4-chlorophenyl)-3-(6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)urea (PubChem CID 73138755) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)urea |
|---|---|
| PubChem CID | 73138755 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1COC2C(O)COC12 |
| InChI | InChI=1S/C13H15ClN2O4/c14-7-1-3-8(4-2-7)15-13(18)16-9-5-19-12-10(17)6-20-11(9)12/h1-4,9-12,17H,5-6H2,(H2,15,16,18) |
| InChIKey | LDSGUSLWXMYFTC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |