C12H15ClN2O2 — CID 40546318
1-(4-chlorophenyl)-3-[(1R,2R)-2-hydroxycyclopentyl]urea (PubChem CID 40546318) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(1R,2R)-2-hydroxycyclopentyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(1R,2R)-2-hydroxycyclopentyl]urea |
|---|---|
| PubChem CID | 40546318 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(1R,2R)-2-hydroxycyclopentyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)N[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C12H15ClN2O2/c13-8-4-6-9(7-5-8)14-12(17)15-10-2-1-3-11(10)16/h4-7,10-11,16H,1-3H2,(H2,14,15,17)/t10-,11-/m1/s1 |
| InChIKey | LULOKAHYLKEDEH-GHMZBOCLSA-N |
| XLogP | 2.37 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |