C13H15ClN2O2 — CID 147474562
1-(4-chlorophenyl)-3-[(1S,5R)-3-hydroxy-6-bicyclo[3.1.0]hexanyl]urea (PubChem CID 147474562) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(1S,5R)-3-hydroxy-6-bicyclo[3.1.0]hexanyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(1S,5R)-3-hydroxy-6-bicyclo[3.1.0]hexanyl]urea |
|---|---|
| PubChem CID | 147474562 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(1S,5R)-3-hydroxy-6-bicyclo[3.1.0]hexanyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1[C@H]2CC(O)C[C@@H]12 |
| InChI | InChI=1S/C13H15ClN2O2/c14-7-1-3-8(4-2-7)15-13(18)16-12-10-5-9(17)6-11(10)12/h1-4,9-12,17H,5-6H2,(H2,15,16,18)/t9?,10-,11+,12? |
| InChIKey | FCKZGJDDNFDAKF-WSVSKBAQSA-N |
| XLogP | 2.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |