C12H17Cl2N3O — CID 53255615
1-(4-chlorophenyl)-3-piperidin-4-ylurea;hydrochloride (PubChem CID 53255615) has the molecular formula C12H17Cl2N3O and a molecular weight of 290.19 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-piperidin-4-ylurea;hydrochloride.
| Compound Name | 1-(4-chlorophenyl)-3-piperidin-4-ylurea;hydrochloride |
|---|---|
| PubChem CID | 53255615 |
| Molecular Formula | C12H17Cl2N3O |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-(4-chlorophenyl)-3-piperidin-4-ylurea;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(Cl)cc1)NC1CCNCC1 |
| InChI | InChI=1S/C12H16ClN3O.ClH/c13-9-1-3-10(4-2-9)15-12(17)16-11-5-7-14-8-6-11;/h1-4,11,14H,5-8H2,(H2,15,16,17);1H |
| InChIKey | RKFKSDABRXRRPV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |