C13H15F4N3O — CID 118409077
1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-piperidin-4-ylurea (PubChem CID 118409077) has the molecular formula C13H15F4N3O and a molecular weight of 305.28 g/mol. Its IUPAC name is 1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-piperidin-4-ylurea.
| Compound Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-piperidin-4-ylurea |
|---|---|
| PubChem CID | 118409077 |
| Molecular Formula | C13H15F4N3O |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-3-piperidin-4-ylurea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)c(F)c1)NC1CCNCC1 |
| InChI | InChI=1S/C13H15F4N3O/c14-11-7-9(1-2-10(11)13(15,16)17)20-12(21)19-8-3-5-18-6-4-8/h1-2,7-8,18H,3-6H2,(H2,19,20,21) |
| InChIKey | WSBSIGSXZLMZOQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |