C13H16FN3O3 — CID 61402803
4-fluoro-3-(piperidin-4-ylcarbamoylamino)benzoic acid (PubChem CID 61402803) has the molecular formula C13H16FN3O3 and a molecular weight of 281.29 g/mol. Its IUPAC name is 4-fluoro-3-(piperidin-4-ylcarbamoylamino)benzoic acid.
| Compound Name | 4-fluoro-3-(piperidin-4-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 61402803 |
| Molecular Formula | C13H16FN3O3 |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-fluoro-3-(piperidin-4-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1cc(C(=O)O)ccc1F)NC1CCNCC1 |
| InChI | InChI=1S/C13H16FN3O3/c14-10-2-1-8(12(18)19)7-11(10)17-13(20)16-9-3-5-15-6-4-9/h1-2,7,9,15H,3-6H2,(H,18,19)(H2,16,17,20) |
| InChIKey | ANYFWSKVBQMSBN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |