C16H21FN4O2 — CID 66661134
1-cyclobutyl-3-[2-fluoro-4-(piperazine-1-carbonyl)phenyl]urea (PubChem CID 66661134) has the molecular formula C16H21FN4O2 and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-cyclobutyl-3-[2-fluoro-4-(piperazine-1-carbonyl)phenyl]urea.
| Compound Name | 1-cyclobutyl-3-[2-fluoro-4-(piperazine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 66661134 |
| Molecular Formula | C16H21FN4O2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-cyclobutyl-3-[2-fluoro-4-(piperazine-1-carbonyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(=O)N2CCNCC2)cc1F)NC1CCC1 |
| InChI | InChI=1S/C16H21FN4O2/c17-13-10-11(15(22)21-8-6-18-7-9-21)4-5-14(13)20-16(23)19-12-2-1-3-12/h4-5,10,12,18H,1-3,6-9H2,(H2,19,20,23) |
| InChIKey | IVRYNLMLOVJIKN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |