C36H43N5O2 — CID 11342211
1-[2-(4-benzhydrylidenepiperidin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-cyclohexylurea (PubChem CID 11342211) has the molecular formula C36H43N5O2 and a molecular weight of 577.77 g/mol. Its IUPAC name is 1-[2-(4-benzhydrylidenepiperidin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-cyclohexylurea.
| Compound Name | 1-[2-(4-benzhydrylidenepiperidin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 11342211 |
| Molecular Formula | C36H43N5O2 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.34 |
| IUPAC Name | 1-[2-(4-benzhydrylidenepiperidin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-cyclohexylurea |
| SMILES | O=C(Nc1cc(C(=O)N2CCNCC2)ccc1N1CCC(=C(c2ccccc2)c2ccccc2)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C36H43N5O2/c42-35(41-24-20-37-21-25-41)30-16-17-33(32(26-30)39-36(43)38-31-14-8-3-9-15-31)40-22-18-29(19-23-40)34(27-10-4-1-5-11-27)28-12-6-2-7-13-28/h1-2,4-7,10-13,16-17,26,31,37H,3,8-9,14-15,18-25H2,(H2,38,39,43) |
| InChIKey | CKOWBQIYSHEULL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |