C37H42N6O2 — CID 11204200
1-[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-(1-phenylethyl)urea (PubChem CID 11204200) has the molecular formula C37H42N6O2 and a molecular weight of 602.78 g/mol. Its IUPAC name is 1-[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-(1-phenylethyl)urea.
| Compound Name | 1-[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 11204200 |
| Molecular Formula | C37H42N6O2 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | 1-[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-(1-phenylethyl)urea |
| SMILES | CC(NC(=O)Nc1cc(C(=O)N2CCNCC2)ccc1N1CCN(C(c2ccccc2)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C37H42N6O2/c1-28(29-11-5-2-6-12-29)39-37(45)40-33-27-32(36(44)43-21-19-38-20-22-43)17-18-34(33)41-23-25-42(26-24-41)35(30-13-7-3-8-14-30)31-15-9-4-10-16-31/h2-18,27-28,35,38H,19-26H2,1H3,(H2,39,40,45) |
| InChIKey | FZMBGHRTFWIPNR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |