C33H35N5O2 — CID 11249599
4-(4-benzhydrylpiperazin-1-yl)-3-[(3,5-dimethylphenyl)carbamoylamino]benzamide (PubChem CID 11249599) has the molecular formula C33H35N5O2 and a molecular weight of 533.68 g/mol. Its IUPAC name is 4-(4-benzhydrylpiperazin-1-yl)-3-[(3,5-dimethylphenyl)carbamoylamino]benzamide.
| Compound Name | 4-(4-benzhydrylpiperazin-1-yl)-3-[(3,5-dimethylphenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 11249599 |
| Molecular Formula | C33H35N5O2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 4-(4-benzhydrylpiperazin-1-yl)-3-[(3,5-dimethylphenyl)carbamoylamino]benzamide |
| SMILES | Cc1cc(C)cc(NC(=O)Nc2cc(C(N)=O)ccc2N2CCN(C(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C33H35N5O2/c1-23-19-24(2)21-28(20-23)35-33(40)36-29-22-27(32(34)39)13-14-30(29)37-15-17-38(18-16-37)31(25-9-5-3-6-10-25)26-11-7-4-8-12-26/h3-14,19-22,31H,15-18H2,1-2H3,(H2,34,39)(H2,35,36,40) |
| InChIKey | NHKNTLIZGAFKTL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |