C34H42N6O2 — CID 11376490
1-[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-cyclopentylurea (PubChem CID 11376490) has the molecular formula C34H42N6O2 and a molecular weight of 566.75 g/mol. Its IUPAC name is 1-[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-cyclopentylurea.
| Compound Name | 1-[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 11376490 |
| Molecular Formula | C34H42N6O2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | 1-[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]-3-cyclopentylurea |
| SMILES | O=C(Nc1cc(C(=O)N2CCNCC2)ccc1N1CCN(C(c2ccccc2)c2ccccc2)CC1)NC1CCCC1 |
| InChI | InChI=1S/C34H42N6O2/c41-33(40-19-17-35-18-20-40)28-15-16-31(30(25-28)37-34(42)36-29-13-7-8-14-29)38-21-23-39(24-22-38)32(26-9-3-1-4-10-26)27-11-5-2-6-12-27/h1-6,9-12,15-16,25,29,32,35H,7-8,13-14,17-24H2,(H2,36,37,42) |
| InChIKey | XTPYOHKTEIKPDC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |