C38H40N6O3 — CID 11467776
(E)-N-[[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]carbamoyl]-3-phenylprop-2-enamide (PubChem CID 11467776) has the molecular formula C38H40N6O3 and a molecular weight of 628.78 g/mol. Its IUPAC name is (E)-N-[[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]carbamoyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]carbamoyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 11467776 |
| Molecular Formula | C38H40N6O3 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | (E)-N-[[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]carbamoyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(=O)Nc1cc(C(=O)N2CCNCC2)ccc1N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C38H40N6O3/c45-35(19-16-29-10-4-1-5-11-29)41-38(47)40-33-28-32(37(46)44-22-20-39-21-23-44)17-18-34(33)42-24-26-43(27-25-42)36(30-12-6-2-7-13-30)31-14-8-3-9-15-31/h1-19,28,36,39H,20-27H2,(H2,40,41,45,47)/b19-16+ |
| InChIKey | PJIRPMKIXDHHNM-KNTRCKAVSA-N |
| XLogP | 5.01 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|