C36H37ClN6O2S — CID 11169744
N-[[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]carbamothioyl]-4-chlorobenzamide (PubChem CID 11169744) has the molecular formula C36H37ClN6O2S and a molecular weight of 653.25 g/mol. Its IUPAC name is N-[[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]carbamothioyl]-4-chlorobenzamide.
| Compound Name | N-[[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]carbamothioyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 11169744 |
| Molecular Formula | C36H37ClN6O2S |
| Molecular Weight | 653.25 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | N-[[2-(4-benzhydrylpiperazin-1-yl)-5-(piperazine-1-carbonyl)phenyl]carbamothioyl]-4-chlorobenzamide |
| SMILES | O=C(NC(=S)Nc1cc(C(=O)N2CCNCC2)ccc1N1CCN(C(c2ccccc2)c2ccccc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H37ClN6O2S/c37-30-14-11-28(12-15-30)34(44)40-36(46)39-31-25-29(35(45)43-19-17-38-18-20-43)13-16-32(31)41-21-23-42(24-22-41)33(26-7-3-1-4-8-26)27-9-5-2-6-10-27/h1-16,25,33,38H,17-24H2,(H2,39,40,44,46) |
| InChIKey | AZVXXFHGOGVIQL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.25 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|