C32H30N4O2S — CID 4948227
N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]benzamide (PubChem CID 4948227) has the molecular formula C32H30N4O2S and a molecular weight of 534.69 g/mol. Its IUPAC name is N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4948227 |
| Molecular Formula | C32H30N4O2S |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C32H30N4O2S/c37-30(26-16-8-3-9-17-26)34-32(39)33-28-19-11-10-18-27(28)31(38)36-22-20-35(21-23-36)29(24-12-4-1-5-13-24)25-14-6-2-7-15-25/h1-19,29H,20-23H2,(H2,33,34,37,39) |
| InChIKey | ZMQSKMMMOVKIOF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|