C37H40N4O3S — CID 4982063
N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-(3-methylbutoxy)benzamide (PubChem CID 4982063) has the molecular formula C37H40N4O3S and a molecular weight of 620.82 g/mol. Its IUPAC name is N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-(3-methylbutoxy)benzamide.
| Compound Name | N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 4982063 |
| Molecular Formula | C37H40N4O3S |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1cccc(C(=O)NC(=S)Nc2ccccc2C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C37H40N4O3S/c1-27(2)20-25-44-31-17-11-16-30(26-31)35(42)39-37(45)38-33-19-10-9-18-32(33)36(43)41-23-21-40(22-24-41)34(28-12-5-3-6-13-28)29-14-7-4-8-15-29/h3-19,26-27,34H,20-25H2,1-2H3,(H2,38,39,42,45) |
| InChIKey | AINDNKYYGZSXSX-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|